4,4'-[Azobis(4,1-phenyleneazo)]bis[N,N,3,5-tetramethylbenzenamine] structure
|
Common Name | 4,4'-[Azobis(4,1-phenyleneazo)]bis[N,N,3,5-tetramethylbenzenamine] | ||
|---|---|---|---|---|
| CAS Number | 69432-31-1 | Molecular Weight | 532.68200 | |
| Density | 1.11g/cm3 | Boiling Point | 707.4ºC at 760mmHg | |
| Molecular Formula | C32H36N8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 381.6ºC | |
| Name | 4-[[4-[[4-[[4-(dimethylamino)-2,6-dimethylphenyl]diazenyl]phenyl]diazenyl]phenyl]diazenyl]-N,N,3,5-tetramethylaniline |
|---|
| Density | 1.11g/cm3 |
|---|---|
| Boiling Point | 707.4ºC at 760mmHg |
| Molecular Formula | C32H36N8 |
| Molecular Weight | 532.68200 |
| Flash Point | 381.6ºC |
| Exact Mass | 532.30600 |
| PSA | 80.64000 |
| LogP | 10.29840 |
| Index of Refraction | 1.608 |
| InChIKey | XNPUYVOJGJELMW-UHFFFAOYSA-N |
| SMILES | Cc1cc(N(C)C)cc(C)c1N=Nc1ccc(N=Nc2ccc(N=Nc3c(C)cc(N(C)C)cc3C)cc2)cc1 |
|
~%
4,4'-[Azobis(4,... CAS#:69432-31-1 |
| Literature: Aftergut, S.; Cole, H. S. Molecular Crystals and Liquid Crystals (1969-1991), 1990 , vol. 188, # l p. 147 - 153 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |