5-methyl-2-(3-nitrophenyl)-4,5-dihydro-1,3-oxazole structure
|
Common Name | 5-methyl-2-(3-nitrophenyl)-4,5-dihydro-1,3-oxazole | ||
|---|---|---|---|---|
| CAS Number | 6943-63-1 | Molecular Weight | 206.19800 | |
| Density | 1.35g/cm3 | Boiling Point | 342.3ºC at 760 mmHg | |
| Molecular Formula | C10H10N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160.8ºC | |
| Name | 5-methyl-2-(3-nitrophenyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 342.3ºC at 760 mmHg |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.19800 |
| Flash Point | 160.8ºC |
| Exact Mass | 206.06900 |
| PSA | 67.41000 |
| LogP | 1.71890 |
| Index of Refraction | 1.619 |
| InChIKey | UOZAQHOJIYVGFA-UHFFFAOYSA-N |
| SMILES | CC1CN=C(c2cccc([N+](=O)[O-])c2)O1 |
|
~%
5-methyl-2-(3-n... CAS#:6943-63-1 |
| Literature: Boyer et al. Journal of the American Chemical Society, 1956 , vol. 78, p. 325 |
|
~%
5-methyl-2-(3-n... CAS#:6943-63-1 |
| Literature: Elfeldt Chemische Berichte, 1891 , vol. 24, p. 3220 |
|
~%
5-methyl-2-(3-n... CAS#:6943-63-1 |
| Literature: Elfeldt Chemische Berichte, 1891 , vol. 24, p. 3220 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 5-methyl-2-(3-nitro-phenyl)-4,5-dihydro-oxazole |