diethyl 2-[(3-chloro-4-methyl-phenyl)amino]propanedioate structure
|
Common Name | diethyl 2-[(3-chloro-4-methyl-phenyl)amino]propanedioate | ||
|---|---|---|---|---|
| CAS Number | 6939-58-8 | Molecular Weight | 299.75000 | |
| Density | 1.231g/cm3 | Boiling Point | 385.8ºC at 760 mmHg | |
| Molecular Formula | C14H18ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.1ºC | |
| Name | diethyl 2-(3-chloro-4-methylanilino)propanedioate |
|---|
| Density | 1.231g/cm3 |
|---|---|
| Boiling Point | 385.8ºC at 760 mmHg |
| Molecular Formula | C14H18ClNO4 |
| Molecular Weight | 299.75000 |
| Flash Point | 187.1ºC |
| Exact Mass | 299.09200 |
| PSA | 64.63000 |
| LogP | 2.62810 |
| Index of Refraction | 1.544 |
| InChIKey | MIEQPARDBZLIEO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(Nc1ccc(C)c(Cl)c1)C(=O)OCC |
|
~50%
diethyl 2-[(3-c... CAS#:6939-58-8 |
| Literature: Maier, Ludwig; Lea, Peter J. Phosphorus and Sulfur and the Related Elements, 1983 , vol. 17, p. 1 - 20 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |