Propanedioic acid,(2-oxo-2-phenylethyl)(phenylmethyl)- (9CI)
Modify Date: 2024-11-29 17:49:40
Propanedioic acid,(2-oxo-2-phenylethyl)(phenylmethyl)- (9CI) structure
|
Common Name | Propanedioic acid,(2-oxo-2-phenylethyl)(phenylmethyl)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 6938-58-5 | Molecular Weight | 312.31700 | |
| Density | 1.317g/cm3 | Boiling Point | 551.9ºC at 760mmHg | |
| Molecular Formula | C18H16O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 301.6ºC | |
| Name | 2-benzyl-2-phenacylpropanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.317g/cm3 |
|---|---|
| Boiling Point | 551.9ºC at 760mmHg |
| Molecular Formula | C18H16O5 |
| Molecular Weight | 312.31700 |
| Flash Point | 301.6ºC |
| Exact Mass | 312.10000 |
| PSA | 91.67000 |
| LogP | 2.65770 |
| Index of Refraction | 1.612 |
| InChIKey | HJLLKGQASYBCEB-UHFFFAOYSA-N |
| SMILES | O=C(CC(Cc1ccccc1)(C(=O)O)C(=O)O)c1ccccc1 |
|
~%
Propanedioic ac... CAS#:6938-58-5 |
| Literature: Drake; Tuemmler Journal of the American Chemical Society, 1955 , vol. 77, p. 1204,1207 |
|
~%
Propanedioic ac... CAS#:6938-58-5 |
| Literature: Drake; Tuemmler Journal of the American Chemical Society, 1955 , vol. 77, p. 1204,1207 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| benzyl-phenacyl-malonic acid |
| benzyl(2-oxo-2-phenylethyl)propanedioic acid |
| Benzyl-phenacyl-malonsaeure |