3-(p-Butoxybenzyl)carbazic acid ethyl ester
Modify Date: 2025-08-25 21:17:00
3-(p-Butoxybenzyl)carbazic acid ethyl ester structure
|
Common Name | 3-(p-Butoxybenzyl)carbazic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 69353-12-4 | Molecular Weight | 266.33600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H22N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl N-[(4-butoxyphenyl)methylamino]carbamate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H22N2O3 |
|---|---|
| Molecular Weight | 266.33600 |
| Exact Mass | 266.16300 |
| PSA | 63.08000 |
| LogP | 3.21150 |
| InChIKey | WQYJZIAJVVJGRD-UHFFFAOYSA-N |
| SMILES | CCCCOc1ccc(CNNC(=O)OCC)cc1 |
| HS Code | 2928000090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:33556-45-5| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| ethyl 2-(4-butoxybenzyl)hydrazinecarboxylate |
| CARBAZIC ACID,3-(p-BUTOXYBENZYL)-,ETHYL ESTER |
| Ethyl (3-(p-butoxy)benzyl)carbazate |
| Carbamic acid,(p-butoxybenzylamino)-,ethyl ester |