2-(2-anilino-2-oxoethyl)benzoic acid structure
|
Common Name | 2-(2-anilino-2-oxoethyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 69338-80-3 | Molecular Weight | 255.26900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2-anilino-2-oxoethyl)benzoic acid |
|---|
| Molecular Formula | C15H13NO3 |
|---|---|
| Molecular Weight | 255.26900 |
| Exact Mass | 255.09000 |
| PSA | 69.89000 |
| LogP | 3.21550 |
| InChIKey | GFBCPKVYPSXTQC-UHFFFAOYSA-N |
| SMILES | O=C(Cc1ccccc1C(=O)O)Nc1ccccc1 |
|
~%
2-(2-anilino-2-... CAS#:69338-80-3 |
| Literature: Boyd,G.V.; Monteil,R.L. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1978 , p. 1338 - 1350 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |