Methanethioic acid,1,1'-tetrathiobis-, O1,O1'-bis(1-methylethyl) ester
Modify Date: 2025-09-26 17:18:47
Methanethioic acid,1,1'-tetrathiobis-, O1,O1'-bis(1-methylethyl) ester structure
|
Common Name | Methanethioic acid,1,1'-tetrathiobis-, O1,O1'-bis(1-methylethyl) ester | ||
|---|---|---|---|---|
| CAS Number | 69303-50-0 | Molecular Weight | 334.58600 | |
| Density | 1.394g/cm3 | Boiling Point | 398.5ºC at 760 mmHg | |
| Molecular Formula | C8H14O2S6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.8ºC | |
| Name | O-propan-2-yl (propan-2-yloxycarbothioyltetrasulfanyl)methanethioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.394g/cm3 |
|---|---|
| Boiling Point | 398.5ºC at 760 mmHg |
| Molecular Formula | C8H14O2S6 |
| Molecular Weight | 334.58600 |
| Flash Point | 194.8ºC |
| Exact Mass | 333.93200 |
| PSA | 183.84000 |
| LogP | 5.08400 |
| Index of Refraction | 1.664 |
| InChIKey | MLJOCCOPXPSSGC-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=S)SSSSC(=S)OC(C)C |
|
~67%
Methanethioic a... CAS#:69303-50-0 |
| Literature: Schroll, Alayne L.; Barany, George Journal of Organic Chemistry, 1986 , vol. 51, # 10 p. 1866 - 1881 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| diisopropyl xanthogen tetrasulphide |
| diisopropyl(tetrathio)dithioformate |
| bis[2-propoxy(thiocarbonyl)]tetrasulfane |