4-(1,2-dimethylindol-3-yl)butanoic acid
Modify Date: 2025-09-18 16:45:51
4-(1,2-dimethylindol-3-yl)butanoic acid structure
|
Common Name | 4-(1,2-dimethylindol-3-yl)butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 69262-84-6 | Molecular Weight | 231.29000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(1,2-dimethylindol-3-yl)butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H17NO2 |
|---|---|
| Molecular Weight | 231.29000 |
| Exact Mass | 231.12600 |
| PSA | 42.23000 |
| LogP | 2.89400 |
| InChIKey | ZQKRHIPBVIFQQH-UHFFFAOYSA-N |
| SMILES | Cc1c(CCCC(=O)O)c2ccccc2n1C |
|
~%
4-(1,2-dimethyl... CAS#:69262-84-6 |
| Literature: Bailey, A. Sydney; Haxby, Joanna B.; Hilton, Andrew N.; Peach, Josephine M.; Vandrevala, Marazban H. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1981 , p. 382 - 389 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1H-Indole-3-butanoic acid,1,2-dimethyl |