Arsonic acid,[4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]phenyl]- (9CI) structure
|
Common Name | Arsonic acid,[4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]phenyl]- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 69239-50-5 | Molecular Weight | 365.00400 | |
| Density | N/A | Boiling Point | 704.9ºC at 760 mmHg | |
| Molecular Formula | C9H7AsCl2N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 380.1ºC | |
| Name | [4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]phenyl]arsonic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 704.9ºC at 760 mmHg |
|---|---|
| Molecular Formula | C9H7AsCl2N4O3 |
| Molecular Weight | 365.00400 |
| Flash Point | 380.1ºC |
| Exact Mass | 363.91100 |
| PSA | 108.23000 |
| LogP | 0.55600 |
| InChIKey | BWKQQQFECMKHNX-UHFFFAOYSA-N |
| SMILES | O=[As](O)(O)c1ccc(Nc2nc(Cl)nc(Cl)n2)cc1 |
|
~%
Arsonic acid,[4... CAS#:69239-50-5 |
| Literature: Friedheim Journal of the American Chemical Society, 1944 , vol. 66, p. 1775,1776,1777 |
| Precursor 2 | |
|---|---|
| DownStream 2 | |
| [4-(4,6-dichloro-[1,3,5]triazin-2-ylamino)-phenyl]-arsonic acid |
| [4-(4,6-Dichlor-[1,3,5]triazin-2-ylamino)-phenyl]-arsonsaeure |