Cyclohexanecarboxamide, N-[2-(1,1-dimethylethyl)phenyl]- (9CI) structure
|
Common Name | Cyclohexanecarboxamide, N-[2-(1,1-dimethylethyl)phenyl]- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 692262-22-9 | Molecular Weight | 259.38600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H25NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[2-(2-Methyl-2-propanyl)phenyl]cyclohexanecarboxamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H25NO |
|---|---|
| Molecular Weight | 259.38600 |
| Exact Mass | 259.19400 |
| PSA | 32.59000 |
| LogP | 5.15240 |
| InChIKey | USNHITBKTUJRPO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccccc1NC(=O)C1CCCCC1 |
|
~91%
Cyclohexanecarb... CAS#:692262-22-9 |
| Literature: Kitagawa, Osamu; Yoshikawa, Masatoshi; Tanabe, Hajime; Morita, Tomofumi; Takahashi, Masashi; Dobashi, Yasuo; Taguchi, Takeo Journal of the American Chemical Society, 2006 , vol. 128, # 39 p. 12923 - 12931 |
| N-(2-tert-butylphenyl)cyclohexanecarboxamide |
| Ethanamine,2-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-N-hydroxy |
| N-(2-tert-butyldimethylsilyloxyethyl)hydroxylamine |