Tigloylgomisin P
Modify Date: 2025-08-26 01:09:53
Tigloylgomisin P structure
|
Common Name | Tigloylgomisin P | ||
|---|---|---|---|---|
| CAS Number | 69176-51-8 | Molecular Weight | 514.56400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H34O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Tigloylgomisin PTigloylgomisin P, a lignin, has anti-HIV activity with an EC50 of 37 μM. Tigloylgomisin P has anticancer effect[1][2]. |
| Name | Schisantherin B |
|---|---|
| Synonym | More Synonyms |
| Description | Tigloylgomisin P, a lignin, has anti-HIV activity with an EC50 of 37 μM. Tigloylgomisin P has anticancer effect[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Tigloylgomisin P displays weak cytotoxicity against A549 cells (GI50=18.77 μM), epidermoid carcinoma of the nasopharynx (KB; GI50=13.91 μM)[1]. |
| References |
| Molecular Formula | C28H34O9 |
|---|---|
| Molecular Weight | 514.56400 |
| Exact Mass | 514.22000 |
| PSA | 101.91000 |
| LogP | 4.61040 |
| InChIKey | BKGUPIVDQHHVMV-TWJXSMCESA-N |
| SMILES | CC=C(C)C(=O)OC1c2cc(OC)c(OC)c(OC)c2-c2c(cc3c(c2OC)OCO3)CC(C)C1(C)O |
| Hazard Codes | Xi |
|---|
| gomisin B |
| Gomisin B |
| 2-BUTENOIC ACID,2-METHYL-,(5R,6R,7S,13AS)-5,6,7,8-TETRAHYDRO-6-HYDROXY-1,2,3,13-TETRAMETHOXY-6,7-DIMETHYLBENZO[3,4]CYCLOOCTA[1,2-F][1,3]BENZODIOXOL-5-YLESTER, (2E)- |