benzo[h][1,6]naphthyridine-5-carboxylic acid
Modify Date: 2025-11-25 19:07:11
![benzo[h][1,6]naphthyridine-5-carboxylic acid Structure](https://image.chemsrc.com/caspic/163/69164-28-9.png)
benzo[h][1,6]naphthyridine-5-carboxylic acid structure
|
Common Name | benzo[h][1,6]naphthyridine-5-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 69164-28-9 | Molecular Weight | 224.21500 | |
| Density | 1.431g/cm3 | Boiling Point | 467.2ºC at 760 mmHg | |
| Molecular Formula | C13H8N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236.3ºC | |
| Name | benzo[h][1,6]naphthyridine-5-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.431g/cm3 |
|---|---|
| Boiling Point | 467.2ºC at 760 mmHg |
| Molecular Formula | C13H8N2O2 |
| Molecular Weight | 224.21500 |
| Flash Point | 236.3ºC |
| Exact Mass | 224.05900 |
| PSA | 63.08000 |
| LogP | 2.48120 |
| Index of Refraction | 1.769 |
| InChIKey | CZTCXHGJESMLCB-UHFFFAOYSA-N |
| SMILES | O=C(O)c1nc2ccccc2c2ncccc12 |
|
~69%
benzo[h][1,6]na... CAS#:69164-28-9 |
| Literature: Bachowska Chemistry of Heterocyclic Compounds, 2011 , vol. 47, # 3 p. 332 - 335 |
![benzo[h][1,6]naphthyridine-5-carbonitrile structure](https://image.chemsrc.com/caspic/454/23985-97-9.png)
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| <1,6>Phenanthrolin-5-carbonsaeure |