3-(4-ethoxyphenyl)-6,7-dimethoxyisochromen-1-one
Modify Date: 2025-09-16 18:04:21
3-(4-ethoxyphenyl)-6,7-dimethoxyisochromen-1-one structure
|
Common Name | 3-(4-ethoxyphenyl)-6,7-dimethoxyisochromen-1-one | ||
|---|---|---|---|---|
| CAS Number | 69052-15-9 | Molecular Weight | 326.34300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(4-ethoxyphenyl)-6,7-dimethoxyisochromen-1-one |
|---|
| Molecular Formula | C19H18O5 |
|---|---|
| Molecular Weight | 326.34300 |
| Exact Mass | 326.11500 |
| PSA | 57.90000 |
| LogP | 3.87590 |
| InChIKey | KFUUPDHVGKORCB-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(-c2cc3cc(OC)c(OC)cc3c(=O)o2)cc1 |
|
~80%
3-(4-ethoxyphen... CAS#:69052-15-9 |
| Literature: Kulkarni; Usgaonkar Journal of the Indian Chemical Society, 1991 , vol. 68, # 9 p. 525 - 526 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |