Binifibrate
Modify Date: 2025-08-25 15:51:23
Binifibrate structure
|
Common Name | Binifibrate | ||
|---|---|---|---|---|
| CAS Number | 69047-39-8 | Molecular Weight | 498.91200 | |
| Density | 1.315g/cm3 | Boiling Point | 629.1ºC at 760 mmHg | |
| Molecular Formula | C25H23ClN2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 334.3ºC | |
Use of BinifibrateBinifibrate is an active compound and has a beneficial effect on lipoprotein metabolism. Binifibrate can be used for the research of hyperlipidemia[1][2]. |
| Name | [2-[2-(4-chlorophenoxy)-2-methylpropanoyl]oxy-3-(pyridine-3-carbonyloxy)propyl] pyridine-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Description | Binifibrate is an active compound and has a beneficial effect on lipoprotein metabolism. Binifibrate can be used for the research of hyperlipidemia[1][2]. |
|---|---|
| Related Catalog |
| Density | 1.315g/cm3 |
|---|---|
| Boiling Point | 629.1ºC at 760 mmHg |
| Molecular Formula | C25H23ClN2O7 |
| Molecular Weight | 498.91200 |
| Flash Point | 334.3ºC |
| Exact Mass | 498.11900 |
| PSA | 113.91000 |
| LogP | 3.91320 |
| Index of Refraction | 1.579 |
| InChIKey | BFYRHDVAEJIBON-UHFFFAOYSA-N |
| SMILES | CC(C)(Oc1ccc(Cl)cc1)C(=O)OC(COC(=O)c1cccnc1)COC(=O)c1cccnc1 |
| Binifibrato |
| Biniwas |
| Binifibrate |
| Binifibrate (INN) |
| WAC 104 |
| Binifibratum [INN-Latin] |
| Binifibrato [INN-Spanish] |
| Glyceryl 2-p-chlorophenoxyisobutyrate-1,3-dinicotinate |