3,3'-[carbonylbis[imino(5-methoxy-2-methyl-p-phenylene)azo]]bis(naphthalene-1,5-disulphonic) acid, compound with 2,2'-iminodiethanol structure
|
Common Name | 3,3'-[carbonylbis[imino(5-methoxy-2-methyl-p-phenylene)azo]]bis(naphthalene-1,5-disulphonic) acid, compound with 2,2'-iminodiethanol | ||
|---|---|---|---|---|
| CAS Number | 68966-49-4 | Molecular Weight | 1034.08000 | |
| Density | N/A | Boiling Point | 1251.7ºC at 760 mmHg | |
| Molecular Formula | C41H43N7O17S4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 710.8ºC | |
| Name | 3-[[4-[[4-[(4,8-disulfonaphthalen-2-yl)diazenyl]-2-methoxy-5-methylphenyl]carbamoylamino]-5-methoxy-2-methylphenyl]diazenyl]naphthalene-1,5-disulfonic acid,2-(2-hydroxyethylamino)ethanol |
|---|
| Boiling Point | 1251.7ºC at 760 mmHg |
|---|---|
| Molecular Formula | C41H43N7O17S4 |
| Molecular Weight | 1034.08000 |
| Flash Point | 710.8ºC |
| Exact Mass | 1033.16000 |
| PSA | 416.01000 |
| LogP | 11.44990 |
| InChIKey | NYZIHEMGFHRHMT-UHFFFAOYSA-N |
| SMILES | COc1cc(N=Nc2cc(S(=O)(=O)O)c3cccc(S(=O)(=O)O)c3c2)c(C)cc1NC(=O)Nc1cc(C)c(N=Nc2cc(S(=O)(=O)O)c3cccc(S(=O)(=O)O)c3c2)cc1OC.OCCNCCO |