ethenyl acetate,1-ethenylpyrrolidin-2-one,2-methylidenebutanedioic acid
Modify Date: 2025-09-16 10:55:12
ethenyl acetate,1-ethenylpyrrolidin-2-one,2-methylidenebutanedioic acid structure
|
Common Name | ethenyl acetate,1-ethenylpyrrolidin-2-one,2-methylidenebutanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 68928-72-3 | Molecular Weight | 327.33000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H21NO7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethenyl acetate,1-ethenylpyrrolidin-2-one,2-methylidenebutanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H21NO7 |
|---|---|
| Molecular Weight | 327.33000 |
| Exact Mass | 327.13200 |
| PSA | 121.21000 |
| LogP | 1.48510 |
| InChIKey | YDFCBRIGTOQHPX-UHFFFAOYSA-N |
| SMILES | C=C(CC(=O)O)C(=O)O.C=CN1CCCC1=O.C=COC(C)=O |
| Butanedioic acid,methylene-,polymer with ethenyl acetate and 1-ethenyl-2-pyrrolidinone |
| Butanedioic acid,2-methylene-,polymer with ethenyl acetate and 1-ethenyl-2-pyrrolidinone |
| N-Vinylpyrrolidinone,vinyl acetate,itaconic acid polymer |
| Methylenebutanedioic acid,polymer with ethenyl acetate and 1-ethenyl-2-pyrrolidinone |
| PVP/VA/Itaconic acid copolymer |