Furo[2,3-b]pyridine-5-carbonitrile,4,6-diamino-2,3-dihydro-2-(hydroxymethyl)- structure
|
Common Name | Furo[2,3-b]pyridine-5-carbonitrile,4,6-diamino-2,3-dihydro-2-(hydroxymethyl)- | ||
|---|---|---|---|---|
| CAS Number | 68846-27-5 | Molecular Weight | 206.20100 | |
| Density | 1.53g/cm3 | Boiling Point | 545.9ºC at 760mmHg | |
| Molecular Formula | C9H10N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 283.9ºC | |
| Name | 4,6-diamino-2-(hydroxymethyl)-2,3-dihydrofuro[2,3-b]pyridine-5-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.53g/cm3 |
|---|---|
| Boiling Point | 545.9ºC at 760mmHg |
| Molecular Formula | C9H10N4O2 |
| Molecular Weight | 206.20100 |
| Flash Point | 283.9ºC |
| Exact Mass | 206.08000 |
| PSA | 118.18000 |
| LogP | 0.57588 |
| Index of Refraction | 1.694 |
| InChIKey | XOCJEUGALYDETB-UHFFFAOYSA-N |
| SMILES | N#Cc1c(N)nc2c(c1N)CC(CO)O2 |
|
~%
Furo[2,3-b]pyri... CAS#:68846-27-5 |
| Literature: Ducker,J.W.; Williams,B.K. Australian Journal of Chemistry, 1978 , vol. 31, p. 2327 - 2331 |
|
~%
Furo[2,3-b]pyri... CAS#:68846-27-5 |
| Literature: Ducker,J.W.; Williams,B.K. Australian Journal of Chemistry, 1978 , vol. 31, p. 2327 - 2331 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| hms2189j10 |