4-(chloromethyl)-2-methoxy-1-nitrobenzene
Modify Date: 2025-08-26 17:14:52
4-(chloromethyl)-2-methoxy-1-nitrobenzene structure
|
Common Name | 4-(chloromethyl)-2-methoxy-1-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 68837-96-7 | Molecular Weight | 201.60700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(chloromethyl)-2-methoxy-1-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H8ClNO3 |
|---|---|
| Molecular Weight | 201.60700 |
| Exact Mass | 201.01900 |
| PSA | 55.05000 |
| LogP | 2.86540 |
| InChIKey | YPGTXBMNSXUGTA-UHFFFAOYSA-N |
| SMILES | COc1cc(CCl)ccc1[N+](=O)[O-] |
|
~99%
4-(chloromethyl... CAS#:68837-96-7 |
| Literature: OSI PHARMACEUTICALS, LLC; CREW, Andrew, P.; DONG, Hanqing; FERRARO, Caterina; SHERMAN, Dan; SIU, Kam, W. Patent: WO2012/74951 A1, 2012 ; Location in patent: Page/Page column 36 ; WO 2012/074951 A1 |
|
~%
4-(chloromethyl... CAS#:68837-96-7 |
| Literature: Hanna,S.B. et al. Journal of the Chemical Society, 1961 , p. 221 - 222 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-Methoxy-4-nitro-benzylchlorid |
| 3-methoxy-4-nitrobenzyl chloride |