1-Boc-2,6-dimethylpiperazine structure
|
Common Name | 1-Boc-2,6-dimethylpiperazine | ||
|---|---|---|---|---|
| CAS Number | 688363-66-8 | Molecular Weight | 214.305 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 279.7±15.0 °C at 760 mmHg | |
| Molecular Formula | C11H22N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 123.0±20.4 °C | |
| Name | 1-Boc-2,6-dimethylpiperazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 279.7±15.0 °C at 760 mmHg |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.305 |
| Flash Point | 123.0±20.4 °C |
| Exact Mass | 214.168121 |
| PSA | 41.57000 |
| LogP | 1.54 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.452 |
| InChIKey | RBOGBIZGALIITO-UHFFFAOYSA-N |
| SMILES | CC1CNCC(C)N1C(=O)OC(C)(C)C |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| tert-butyl 2,6-dimethylpiperazine-1-carboxylate |
| 2-Methyl-2-propanyl 2,6-dimethyl-1-piperazinecarboxylate |
| 1-Piperazinecarboxylic acid, 2,6-dimethyl-, 1,1-dimethylethyl ester |