5-O-(tert-Butyldimethylsilyl)-2,3-O-isoproylidene-D-ribofuranose structure
|
Common Name | 5-O-(tert-Butyldimethylsilyl)-2,3-O-isoproylidene-D-ribofuranose | ||
|---|---|---|---|---|
| CAS Number | 68703-51-5 | Molecular Weight | 304.45500 | |
| Density | 1.036g/cm3 | Boiling Point | 371.2ºC at 760 mmHg | |
| Molecular Formula | C14H28O5Si | Melting Point | 50-51ºC | |
| MSDS | N/A | Flash Point | 178.3ºC | |
| Name | 5-O-tert-Butyldimethylsilyl-2,3-O-isopropylidene-alpha,beta-D-ribofuranose |
|---|---|
| Synonym | More Synonyms |
| Density | 1.036g/cm3 |
|---|---|
| Boiling Point | 371.2ºC at 760 mmHg |
| Melting Point | 50-51ºC |
| Molecular Formula | C14H28O5Si |
| Molecular Weight | 304.45500 |
| Flash Point | 178.3ºC |
| Exact Mass | 304.17100 |
| PSA | 57.15000 |
| LogP | 2.24550 |
| Index of Refraction | 1.455 |
| InChIKey | JJLRGSYXWAKGJM-MAPNCKNWSA-N |
| SMILES | CC1(C)OC2C(O)OC(CO[Si](C)(C)C(C)(C)C)C2O1 |
| Storage condition | -20°C Freezer |
| Water Solubility | Soluble in dichloromethane and ethyl acetate. |
| HS Code | 2932999099 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD01075716 |
| 5-O-(tert-Butyldimethylsilyl)-2,3-O-isoproylidene-D-ribofuranose |