N-ethyl-4-[2-[4-(ethylsulfamoyl)phenoxy]ethoxy]benzenesulfonamide structure
|
Common Name | N-ethyl-4-[2-[4-(ethylsulfamoyl)phenoxy]ethoxy]benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 68641-76-9 | Molecular Weight | 428.52300 | |
| Density | 1.288g/cm3 | Boiling Point | 614.3ºC at 760 mmHg | |
| Molecular Formula | C18H24N2O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 325.3ºC | |
| Name | N-ethyl-4-[2-[4-(ethylsulfamoyl)phenoxy]ethoxy]benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.288g/cm3 |
|---|---|
| Boiling Point | 614.3ºC at 760 mmHg |
| Molecular Formula | C18H24N2O6S2 |
| Molecular Weight | 428.52300 |
| Flash Point | 325.3ºC |
| Exact Mass | 428.10800 |
| PSA | 127.56000 |
| LogP | 4.68420 |
| Index of Refraction | 1.56 |
| InChIKey | UCXJSLCDURTRIZ-UHFFFAOYSA-N |
| SMILES | CCNS(=O)(=O)c1ccc(OCCOc2ccc(S(=O)(=O)NCC)cc2)cc1 |
|
~%
N-ethyl-4-[2-[4... CAS#:68641-76-9 |
| Literature: King Journal of the American Chemical Society, 1944 , vol. 66, p. 2076,2079 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4,4'-ethanediyldimercapto-di-phenol |
| 4,4'-Aethandiyldioxy-bis-benzolsulfonsaeure-bis-aethylamid |
| 4,4'-Aethandiyldimercapto-di-phenol |
| 4,4'-ethanediyldioxy-bis-benzenesulfonic acid bis-ethylamide |