N-propyl-4-[2-[4-(propylsulfamoyl)phenoxy]ethoxy]benzenesulfonamide
Modify Date: 2025-08-23 09:07:37
![N-propyl-4-[2-[4-(propylsulfamoyl)phenoxy]ethoxy]benzenesulfonamide Structure](https://image.chemsrc.com/caspic/041/68641-73-6.png)
N-propyl-4-[2-[4-(propylsulfamoyl)phenoxy]ethoxy]benzenesulfonamide structure
|
Common Name | N-propyl-4-[2-[4-(propylsulfamoyl)phenoxy]ethoxy]benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 68641-73-6 | Molecular Weight | 456.57600 | |
| Density | 1.249g/cm3 | Boiling Point | 629.5ºC at 760 mmHg | |
| Molecular Formula | C20H28N2O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 334.5ºC | |
| Name | 4,4'-Aethandiyldioxy-bis-benzolsulfonsaeure-bis-methylamid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.249g/cm3 |
|---|---|
| Boiling Point | 629.5ºC at 760 mmHg |
| Molecular Formula | C20H28N2O6S2 |
| Molecular Weight | 456.57600 |
| Flash Point | 334.5ºC |
| Exact Mass | 456.13900 |
| PSA | 127.56000 |
| LogP | 5.46440 |
| Index of Refraction | 1.552 |
| InChIKey | YSFDZRZLWMCFFN-UHFFFAOYSA-N |
| SMILES | CCCNS(=O)(=O)c1ccc(OCCOc2ccc(S(=O)(=O)NCCC)cc2)cc1 |
|
~%
N-propyl-4-[2-[... CAS#:68641-73-6 |
| Literature: King Journal of the American Chemical Society, 1944 , vol. 66, p. 2076,2079 |
|
~%
N-propyl-4-[2-[... CAS#:68641-73-6 |
| Literature: King Journal of the American Chemical Society, 1944 , vol. 66, p. 2076,2079 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4,4'-ethanediyldioxy-bis-benzenesulfonic acid bis-isopropylamide |
| 4,4'-ethanediyldioxy-bis-benzenesulfonic acid bis-methylamide |
| 4,4'-Aethandiyldioxy-bis-benzolsulfonsaeure-bis-propylamid |
| 4,4'-ethanediyldioxy-bis-benzenesulfonic acid bis-propylamide |
| 4-(4-Methyl-1-penten-3-yl)-1-cyclohexene-3-carboxaldehyde |
| 6-(1-(1-Methylethyl)allyl)cyclohex-2-ene-1-carbaldehyde |
| 4,4'-Aethandiyldioxy-bis-benzolsulfonsaeure-bis-isopropylamid |