azanium,methyl 2-methylprop-2-enoate,oxiran-2-ylmethyl 2-methylprop-2-enoate
Modify Date: 2025-08-20 14:11:12
azanium,methyl 2-methylprop-2-enoate,oxiran-2-ylmethyl 2-methylprop-2-enoate structure
|
Common Name | azanium,methyl 2-methylprop-2-enoate,oxiran-2-ylmethyl 2-methylprop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 68584-75-8 | Molecular Weight | 259.29900 | |
| Density | N/A | Boiling Point | 189ºC at 760mmHg | |
| Molecular Formula | C12H21NO5+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 76.1ºC | |
| Name | azanium,methyl 2-methylprop-2-enoate,oxiran-2-ylmethyl 2-methylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 189ºC at 760mmHg |
|---|---|
| Molecular Formula | C12H21NO5+ |
| Molecular Weight | 259.29900 |
| Flash Point | 76.1ºC |
| Exact Mass | 259.14200 |
| PSA | 68.37000 |
| LogP | 1.56390 |
| InChIKey | YBUCPIDNZJLROZ-UHFFFAOYSA-O |
| SMILES | C=C(C)C(=O)OC.C=C(C)C(=O)OCC1CO1.[NH4+] |
| 2-Propenoic acid,2-methyl-,methyl ester,polymer with oxiranylmethyl 2-methyl-2-propenoate,ammonia-modified |
| Glycidyl methacrylate,methyl methacrylate polymer,ammonia modified |
| 2-Propenoic acid,2-methyl-,methyl ester,polymer with 2-oxiranylmethyl 2-methyl-2-propenoate,ammonia-modified |