diethyl quinolin-8-yl phosphate structure
|
Common Name | diethyl quinolin-8-yl phosphate | ||
|---|---|---|---|---|
| CAS Number | 6854-01-9 | Molecular Weight | 281.24400 | |
| Density | 1.238g/cm3 | Boiling Point | 368.4ºC at 760 mmHg | |
| Molecular Formula | C13H16NO4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.6ºC | |
| Name | diethyl quinolin-8-yl phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.238g/cm3 |
|---|---|
| Boiling Point | 368.4ºC at 760 mmHg |
| Molecular Formula | C13H16NO4P |
| Molecular Weight | 281.24400 |
| Flash Point | 176.6ºC |
| Exact Mass | 281.08200 |
| PSA | 67.46000 |
| LogP | 3.79470 |
| Index of Refraction | 1.556 |
| InChIKey | MPGQNMMAGNXHSR-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(OCC)Oc1cccc2cccnc12 |
|
~58%
diethyl quinoli... CAS#:6854-01-9 |
| Literature: Karimov, D. T.; Dalimov, D. N.; Abduvakhabov, A. A.; Godovikov, N. N. J. Gen. Chem. USSR (Engl. Transl.), 1983 , vol. 53, # 5 p. 1181 - 1185,1049 - 1052 |
|
~%
diethyl quinoli... CAS#:6854-01-9 |
| Literature: Andrews et al. Journal of the Chemical Society, 1954 , p. 1638 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| phosphoric acid diethyl ester quinolin-8-yl ester |
| 8-Diethoxyphosphoryloxy-chinolin |
| Phosphoric acid,diethyl 8-quinolyl ester |
| Phosphoric acid,diethyl 8-quinolinyl ester |
| diethyl 8-quinolyl phosphate |
| Diethyl 8-quinolinyl phosphate |