1,4,6,7-tetramethylanthracene-9,10-dione structure
|
Common Name | 1,4,6,7-tetramethylanthracene-9,10-dione | ||
|---|---|---|---|---|
| CAS Number | 68498-92-0 | Molecular Weight | 264.31800 | |
| Density | 1.179g/cm3 | Boiling Point | 448.2ºC at 760 mmHg | |
| Molecular Formula | C18H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167ºC | |
| Name | 1,4,6,7-tetramethylanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.179g/cm3 |
|---|---|
| Boiling Point | 448.2ºC at 760 mmHg |
| Molecular Formula | C18H16O2 |
| Molecular Weight | 264.31800 |
| Flash Point | 167ºC |
| Exact Mass | 264.11500 |
| PSA | 34.14000 |
| LogP | 3.69560 |
| Index of Refraction | 1.612 |
| InChIKey | QBRSAPKMZOCSRP-UHFFFAOYSA-N |
| SMILES | Cc1cc2c(cc1C)C(=O)c1c(C)ccc(C)c1C2=O |
|
~%
1,4,6,7-tetrame... CAS#:68498-92-0 |
| Literature: Fieser; Fieser Journal of the American Chemical Society, 1935 , vol. 57, p. 1679 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,3,6,7-Tetramethylanthrachinon |
| 1,4,6,7-Tetramethyl-anthrachinon |
| 1,4,6,7-tetramethyl-anthraquinone |