2,2'-iminobisethanol, compound with 5-methyl-1H-benzotriazole (1:1) structure
|
Common Name | 2,2'-iminobisethanol, compound with 5-methyl-1H-benzotriazole (1:1) | ||
|---|---|---|---|---|
| CAS Number | 68480-33-1 | Molecular Weight | 220.30700 | |
| Density | N/A | Boiling Point | 289.3ºC at 760 mmHg | |
| Molecular Formula | C14H20O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 137.4ºC | |
| Name | 5-tert-butyl-2-methoxy-4-prop-2-enylphenol |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 289.3ºC at 760 mmHg |
|---|---|
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.30700 |
| Flash Point | 137.4ºC |
| Exact Mass | 220.14600 |
| PSA | 29.46000 |
| LogP | 3.42680 |
| InChIKey | WBEBXGSQWKBFLK-UHFFFAOYSA-N |
| SMILES | Cc1ccc2n[nH]nc2c1.OCCNCCO |
| EINECS 267-503-7 |
| 4-allyl-5-tert-butyl-2-methoxyphenol |