3,6,9,12,15,18,21-Heptaoxa-27-azabicyclo(21.3.1)heptacosa-1(27),23,25-triene-2,22-dione structure
|
Common Name | 3,6,9,12,15,18,21-Heptaoxa-27-azabicyclo(21.3.1)heptacosa-1(27),23,25-triene-2,22-dione | ||
|---|---|---|---|---|
| CAS Number | 68436-53-3 | Molecular Weight | 413.41900 | |
| Density | 1.144g/cm3 | Boiling Point | 678.1ºC at 760 mmHg | |
| Molecular Formula | C19H27NO9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 363.9ºC | |
| Name | 3,6,9,12,15,18,21-heptaoxa-27-azabicyclo[21.3.1]heptacosa-1(27),23,25-triene-2,22-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.144g/cm3 |
|---|---|
| Boiling Point | 678.1ºC at 760 mmHg |
| Molecular Formula | C19H27NO9 |
| Molecular Weight | 413.41900 |
| Flash Point | 363.9ºC |
| Exact Mass | 413.16900 |
| PSA | 111.64000 |
| LogP | 0.49180 |
| Index of Refraction | 1.458 |
| InChIKey | GXVCDVRALIXBEW-UHFFFAOYSA-N |
| SMILES | O=C1OCCOCCOCCOCCOCCOCCOC(=O)c2cccc1n2 |
|
~%
3,6,9,12,15,18,... CAS#:68436-53-3 |
| Literature: Bradshaw,J.S. et al. Journal of Heterocyclic Chemistry, 1978 , vol. 15, p. 825 - 831 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3,6,9,12,15,18,21-heptaoxa-27-azabicyclo<21.3.1>heptacosa-1(27),23,25-triene-2,22-dione |
| 6319P |
| 3,6,9,12,15,18,21-heptaoxa-1(2,6)-pyridina-cyclodocosaphane-2,22-dione |