Benzenesulfonic acid,4-methyl-, 2-(2-oxo-1,2-diphenylethylidene)hydrazide structure
|
Common Name | Benzenesulfonic acid,4-methyl-, 2-(2-oxo-1,2-diphenylethylidene)hydrazide | ||
|---|---|---|---|---|
| CAS Number | 68384-27-0 | Molecular Weight | 378.44400 | |
| Density | 1.21g/cm3 | Boiling Point | 548.8ºC at 760 mmHg | |
| Molecular Formula | C21H18N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 285.7ºC | |
| Name | bisbenzoylthiosemicarbazone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 548.8ºC at 760 mmHg |
| Molecular Formula | C21H18N2O3S |
| Molecular Weight | 378.44400 |
| Flash Point | 285.7ºC |
| Exact Mass | 378.10400 |
| PSA | 83.98000 |
| LogP | 5.03220 |
| Index of Refraction | 1.612 |
| InChIKey | UKKUHNOVVHRCKS-XDOYNYLZSA-N |
| SMILES | Cc1ccc(S(=O)(=O)NN=C(C(=O)c2ccccc2)c2ccccc2)cc1 |
|
~%
Benzenesulfonic... CAS#:68384-27-0 |
| Literature: Kumar; Singh Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2001 , vol. 40, # 7 p. 579 - 583 |
|
~%
Benzenesulfonic... CAS#:68384-27-0 |
| Literature: Kumar; Singh Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2001 , vol. 40, # 7 p. 579 - 583 |
| benzilmonothiosemicarbazone |
| benzil monotosylhydrazone |
| Benzil-mono-thiosemicarbazon |