2-(2-methylpent-4-en-2-yl)-1H-indole structure
|
Common Name | 2-(2-methylpent-4-en-2-yl)-1H-indole | ||
|---|---|---|---|---|
| CAS Number | 683800-29-5 | Molecular Weight | 199.29100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H17N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2-methylpent-4-en-2-yl)-1H-indole |
|---|
| Molecular Formula | C14H17N |
|---|---|
| Molecular Weight | 199.29100 |
| Exact Mass | 199.13600 |
| PSA | 15.79000 |
| LogP | 4.02160 |
| InChIKey | SCFIFFAYGJDOKR-UHFFFAOYSA-N |
| SMILES | C=CCC(C)(C)c1cc2ccccc2[nH]1 |
|
~42%
2-(2-methylpent... CAS#:683800-29-5 |
| Literature: Liu, Cong; Han, Xiaoqing; Wang, Xiang; Widenhoefer, Ross A. Journal of the American Chemical Society, 2004 , vol. 126, # 12 p. 3700 - 3701 |