methyl 3,4,5-triacetyloxy-6-carbamimidoylsulfanyl-oxane-2-carboxylate structure
|
Common Name | methyl 3,4,5-triacetyloxy-6-carbamimidoylsulfanyl-oxane-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 68354-88-1 | Molecular Weight | 473.29400 | |
| Density | 1.53g/cm3 | Boiling Point | 469.8ºC at 760 mmHg | |
| Molecular Formula | C14H21BrN2O9S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237.9ºC | |
| Name | methyl 3,4,5-triacetyloxy-6-carbamimidoylsulfanyloxane-2-carboxylate,hydrobromide |
|---|
| Density | 1.53g/cm3 |
|---|---|
| Boiling Point | 469.8ºC at 760 mmHg |
| Molecular Formula | C14H21BrN2O9S |
| Molecular Weight | 473.29400 |
| Flash Point | 237.9ºC |
| Exact Mass | 472.01500 |
| PSA | 189.60000 |
| LogP | 1.06420 |
| Index of Refraction | 1.585 |
| InChIKey | LYPBKNTWSBOISR-UHFFFAOYSA-N |
| SMILES | Br.COC(=O)C1OC(SC(=N)N)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
|
~%
methyl 3,4,5-tr... CAS#:68354-88-1 |
| Literature: Leydet, Alain; Jeantet-Segonds, Christine; Barthelemy, Philippe; Boyer, Bernard; Roque, Jean Pierre Recueil des Travaux Chimiques des Pays-Bas-Journal of the Royal Netherlands, 1996 , vol. 115, # 10 p. 421 - 426 |
|
~%
methyl 3,4,5-tr... CAS#:68354-88-1 |
| Literature: Leydet, Alain; Jeantet-Segonds, Christine; Barthelemy, Philippe; Boyer, Bernard; Roque, Jean Pierre Recueil des Travaux Chimiques des Pays-Bas-Journal of the Royal Netherlands, 1996 , vol. 115, # 10 p. 421 - 426 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |