2,4(1H,3H)-Pyrimidinedione,1-(diphenylmethyl)-5-fluoro- structure
|
Common Name | 2,4(1H,3H)-Pyrimidinedione,1-(diphenylmethyl)-5-fluoro- | ||
|---|---|---|---|---|
| CAS Number | 68321-45-9 | Molecular Weight | 296.29600 | |
| Density | 1.34g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C17H13FN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-benzhydryl-5-fluoropyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Molecular Formula | C17H13FN2O2 |
| Molecular Weight | 296.29600 |
| Exact Mass | 296.09600 |
| PSA | 54.86000 |
| LogP | 2.31340 |
| Index of Refraction | 1.647 |
| InChIKey | XTAOOKSIHMFYDD-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c(=O)n(C(c2ccccc2)c2ccccc2)cc1F |
|
~87%
2,4(1H,3H)-Pyri... CAS#:68321-45-9 |
| Literature: Wu, Fan; Buhendwa, Musole G.; Weaver, Donald F. Journal of Organic Chemistry, 2004 , vol. 69, # 26 p. 9307 - 9309 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-benzhydryl-5-fluoro-1H-pyrimidine-2,4-dione |
| 1-Benzhydryl-5-fluoruracil |