benzoic acid, compound with 4-[(4-aminophenyl)(4-iminocyclohexa-2,5-dien-1-ylidene)methyl]-o-toluidine (1:1) structure
|
Common Name | benzoic acid, compound with 4-[(4-aminophenyl)(4-iminocyclohexa-2,5-dien-1-ylidene)methyl]-o-toluidine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 68310-88-3 | Molecular Weight | 332.36800 | |
| Density | N/A | Boiling Point | 569.7ºC at 760 mmHg | |
| Molecular Formula | C22H17FO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 298.4ºC | |
| Name | (5-fluoro-12-methylbenzo[a]anthracen-7-yl)methyl acetate |
|---|
| Boiling Point | 569.7ºC at 760 mmHg |
|---|---|
| Molecular Formula | C22H17FO2 |
| Molecular Weight | 332.36800 |
| Flash Point | 298.4ºC |
| Exact Mass | 332.12100 |
| PSA | 26.30000 |
| LogP | 5.65680 |
| InChIKey | IAQOSXVGHHEUBZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(c2ccc(N)cc2)c2ccc(N)cc2)C=CC1=N.O=C(O)c1ccccc1 |