2-amino-3-formyl-6-methylchromone structure
|
Common Name | 2-amino-3-formyl-6-methylchromone | ||
|---|---|---|---|---|
| CAS Number | 68301-75-7 | Molecular Weight | 203.19400 | |
| Density | 1.415g/cm3 | Boiling Point | 427.7ºC at 760 mmHg | |
| Molecular Formula | C11H9NO3 | Melting Point | 284-286ºC | |
| MSDS | N/A | Flash Point | 249.8ºC | |
| Name | 2-amino-6-methyl-4-oxochromene-3-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.415g/cm3 |
|---|---|
| Boiling Point | 427.7ºC at 760 mmHg |
| Melting Point | 284-286ºC |
| Molecular Formula | C11H9NO3 |
| Molecular Weight | 203.19400 |
| Flash Point | 249.8ºC |
| Exact Mass | 203.05800 |
| PSA | 73.30000 |
| LogP | 2.07730 |
| Index of Refraction | 1.688 |
| InChIKey | ZUOLPKRXZRWAFV-UHFFFAOYSA-N |
| SMILES | Cc1ccc2oc(N)c(C=O)c(=O)c2c1 |
| HS Code | 2922509090 |
|---|
|
~69%
2-amino-3-formy... CAS#:68301-75-7 |
| Literature: Ishiguro, Toshihiro; Ukawa, Kiyoshi; Sugihara, Hirosada; Nohara, Akira Heterocycles, 1981 , vol. 16, # 5 p. 733 - 740 |
|
~81%
2-amino-3-formy... CAS#:68301-75-7 |
| Literature: Ghosh, Chandra Kanta; Tewari, Nimai; Bandyopadhyay, Chandrakanta Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1983 , vol. 22, # 12 p. 1200 - 1204 |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Amino-3-formyl-6-methylchromone |
| HMS2394K14 |
| 2-amino-6-methyl-4-oxo-4H-chromene-3-carbaldehyde |
| 2-amino-6-methylchromone-3-carboxaldehyde |
| 6-methyl-2-amino-3-formyl chromone |