4-Chloro-2-Methoxy-5-nitro-benzoic acid
Modify Date: 2025-08-25 11:37:04
4-Chloro-2-Methoxy-5-nitro-benzoic acid structure
|
Common Name | 4-Chloro-2-Methoxy-5-nitro-benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 68255-77-6 | Molecular Weight | 231.59000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H6ClNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-chloro-2-methoxy-5-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H6ClNO5 |
|---|---|
| Molecular Weight | 231.59000 |
| Exact Mass | 230.99300 |
| PSA | 92.35000 |
| LogP | 2.47820 |
| InChIKey | RSBXOVZBSUWTCT-UHFFFAOYSA-N |
| SMILES | COc1cc(Cl)c([N+](=O)[O-])cc1C(=O)O |
| HS Code | 2918990090 |
|---|
|
~%
4-Chloro-2-Meth... CAS#:68255-77-6 |
| Literature: Eisai Co., Ltd. Patent: US6518423 B1, 2003 ; |
|
~%
4-Chloro-2-Meth... CAS#:68255-77-6 |
| Literature: Goldstein; Schaaf Helvetica Chimica Acta, 1957 , vol. 40, p. 369,372 |
|
~%
4-Chloro-2-Meth... CAS#:68255-77-6 |
| Literature: Goldstein; Schaaf Helvetica Chimica Acta, 1957 , vol. 40, p. 369,372 |
CAS#:109069-75-2![4-chloro-N-[(1-ethylpyrrolidin-2-yl)methyl]-2-methoxy-5-(sulfamoylamino)benzamide structure](https://image.chemsrc.com/caspic/401/68256-25-7.png)
CAS#:68256-25-7
CAS#:90564-41-3![4-chloro-N-[(1-ethylpyrrolidin-2-yl)methyl]-2-methoxy-5-[methyl(sulfamoyl)amino]benzamide structure](https://image.chemsrc.com/caspic/092/90763-45-4.png)
CAS#:90763-45-4| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzoic acid,4-chloro-2-methoxy-5-nitro |
| 2-methoxy-4-chloro-5-nitrobenzoic acid |
| QC-8537 |
| 4-Chlor-2-methoxy-5-nitro-benzoesaeure |
| 4-chloro-5-nitro-o-anisic acid |
| 4-chloro-2-methoxy-5-nitro-benzoic acid |