N-(2-chloro-4-sulfamoylphenyl)-2-phenylacetamide structure
|
Common Name | N-(2-chloro-4-sulfamoylphenyl)-2-phenylacetamide | ||
|---|---|---|---|---|
| CAS Number | 68252-75-5 | Molecular Weight | 324.78300 | |
| Density | 1.449g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H13ClN2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(2-chloro-4-sulfamoylphenyl)-2-phenylacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.449g/cm3 |
|---|---|
| Molecular Formula | C14H13ClN2O3S |
| Molecular Weight | 324.78300 |
| Exact Mass | 324.03400 |
| PSA | 101.13000 |
| LogP | 4.59920 |
| Index of Refraction | 1.65 |
| InChIKey | PCTUCNXXOLZRTM-UHFFFAOYSA-N |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)Cc2ccccc2)c(Cl)c1 |
|
~35%
N-(2-chloro-4-s... CAS#:68252-75-5 |
| Literature: Guezel, Oezlen; Innocenti, Alessio; Scozzafava, Andrea; Salman, Aydin; Supuran, Claudiu T. Bioorganic and Medicinal Chemistry, 2009 , vol. 17, # 14 p. 4894 - 4899 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| sulfonamide deriv.,7e |
| 3-Chloro-4-phenacetamido-benzenesulfonamide |