2,2-dimethyl-6-phenylthian-4-one
Modify Date: 2025-09-24 17:08:19
2,2-dimethyl-6-phenylthian-4-one structure
|
Common Name | 2,2-dimethyl-6-phenylthian-4-one | ||
|---|---|---|---|---|
| CAS Number | 68226-11-9 | Molecular Weight | 220.33100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2-dimethyl-6-phenylthian-4-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H16OS |
|---|---|
| Molecular Weight | 220.33100 |
| Exact Mass | 220.09200 |
| PSA | 42.37000 |
| LogP | 3.60240 |
| InChIKey | INEXSFKPSHXRHP-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(=O)CC(c2ccccc2)S1 |
|
~%
2,2-dimethyl-6-... CAS#:68226-11-9 |
| Literature: Arndt; Pusch Chemische Berichte, 1925 , vol. 58, p. 1647 |
|
~%
2,2-dimethyl-6-... CAS#:68226-11-9 |
| Literature: Arjunan, Periaswamy Gounder; Lakshmanan, Joghee Gowder; Chandrasekara, Nallappan; Ramalingam, Kondareddiar; Selvaraj, Kuppusamy Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1985 , p. 1183 - 1186 |
|
~%
2,2-dimethyl-6-... CAS#:68226-11-9 |
| Literature: Arjunan, Periaswamy Gounder; Lakshmanan, Joghee Gowder; Chandrasekara, Nallappan; Ramalingam, Kondareddiar; Selvaraj, Kuppusamy Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1985 , p. 1183 - 1186 |
|
~%
2,2-dimethyl-6-... CAS#:68226-11-9 |
| Literature: Nanjappan, Palaniappan; Satyamurthy, Nagichetti; Ramalingam, Kondareddiar Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1980 , p. 714 - 716 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,2-dimethyl-6-phenyl-tetrahydro-thiopyran-4-one |
| 2,2-Dimethyl-6-phenyl-tetrahydro-thiopyran-4-on |
| 4H-Thiopyran-4-one,tetrahydro-,2,2-dimethyl-6-phenyl |
| 4-oxo-2-phenyl-6,6-dimethyl-thiane |
| 1-thia-2,2-dimethyl-6eq-phenyl-4-cyclohexanone |
| 2,2-Dimethyl-6-phenyl-4-thianone |