2-chloro-5-[(phenylamino)sulphonyl]benzoic acid structure
|
Common Name | 2-chloro-5-[(phenylamino)sulphonyl]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 68189-34-4 | Molecular Weight | 311.74100 | |
| Density | 1.535g/cm3 | Boiling Point | 513ºC at 760 mmHg | |
| Molecular Formula | C13H10ClNO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 264ºC | |
| Name | 2-chloro-5-(phenylsulfamoyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.535g/cm3 |
|---|---|
| Boiling Point | 513ºC at 760 mmHg |
| Molecular Formula | C13H10ClNO4S |
| Molecular Weight | 311.74100 |
| Flash Point | 264ºC |
| Exact Mass | 311.00200 |
| PSA | 91.85000 |
| LogP | 3.99280 |
| Index of Refraction | 1.66 |
| InChIKey | BYKANEVMPOZIQF-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(S(=O)(=O)Nc2ccccc2)ccc1Cl |
|
~%
2-chloro-5-[(ph... CAS#:68189-34-4 |
| Literature: Basu; Das-Gupta Journal of the Indian Chemical Society, 1939 , vol. 16, p. 100,106 |
|
~%
2-chloro-5-[(ph... CAS#:68189-34-4 |
| Literature: Basu; Das-Gupta Journal of the Indian Chemical Society, 1939 , vol. 16, p. 100,106 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-chloro-5-phenylsulfamoyl-benzoic acid |
| 2-Chlor-5-phenylsulfamoyl-benzoesaeure |