4-butyl-1,2-diphenylpyrazolidine-3,5-dione,2-(dimethylamino)ethanol
Modify Date: 2025-11-26 12:51:41
4-butyl-1,2-diphenylpyrazolidine-3,5-dione,2-(dimethylamino)ethanol structure
|
Common Name | 4-butyl-1,2-diphenylpyrazolidine-3,5-dione,2-(dimethylamino)ethanol | ||
|---|---|---|---|---|
| CAS Number | 68141-47-9 | Molecular Weight | 397.51100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H31N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-butyl-1,2-diphenylpyrazolidine-3,5-dione,2-(dimethylamino)ethanol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C23H31N3O3 |
|---|---|
| Molecular Weight | 397.51100 |
| Exact Mass | 397.23700 |
| PSA | 64.09000 |
| LogP | 3.45810 |
| InChIKey | BRBNJZRSGQDYQW-UHFFFAOYSA-N |
| SMILES | CCCCC1C(=O)N(c2ccccc2)N(c2ccccc2)C1=O.CN(C)CCO |
| 3,5-Pyrazolidinedione,4-butyl-1,2-diphenyl-,compd. with 2-(dimethylamino)ethanol |
| 2-(Dimethylamino)ethanol compd. with 4-butyl-1,2-diphenyl-3,5-pyrazolidinedione |
| 4-Butyl-1,2-diphenyl-3,5-pyrazolidinedione compd. with 2-(dimethylamino)ethanol |