1,1-bis(ethenoxy)butane,formaldehyde,phenol structure
|
Common Name | 1,1-bis(ethenoxy)butane,formaldehyde,phenol | ||
|---|---|---|---|---|
| CAS Number | 68140-67-0 | Molecular Weight | 266.33300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H22O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1-bis(ethenoxy)butane,formaldehyde,phenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H22O4 |
|---|---|
| Molecular Weight | 266.33300 |
| Exact Mass | 266.15200 |
| PSA | 55.76000 |
| LogP | 4.27600 |
| InChIKey | SQNVYKWXUZDTMV-UHFFFAOYSA-N |
| SMILES | C=COC(CCC)OC=C.C=O.Oc1ccccc1 |
| Formaldehyde,polymer with 1,1-bis(ethenyloxy)butane and phenol |
| 1,1-bis(ethenoxy)butane |
| Phenol,formaldehyde,divinyl butyral polymer |