β-Carotin structure
|
Common Name | β-Carotin | ||
|---|---|---|---|---|
| CAS Number | 6811-73-0 | Molecular Weight | 536.87300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C40H56 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | β-Carotin |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C40H56 |
|---|---|
| Molecular Weight | 536.87300 |
| Exact Mass | 536.43800 |
| LogP | 12.60580 |
| InChIKey | OENHQHLEOONYIE-MZMZTKINSA-N |
| SMILES | CC(C=CC=C(C)C=CC1=C(C)CCCC1(C)C)=CC=CC=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C |
| HS Code | 2915900090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| 13-cis-beta,beta-carotene |