ethyl ester of 3-(3-indolyl)butyric acid structure
|
Common Name | ethyl ester of 3-(3-indolyl)butyric acid | ||
|---|---|---|---|---|
| CAS Number | 67996-15-0 | Molecular Weight | 231.29000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl ester of 3-(3-indolyl)butyric acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H17NO2 |
|---|---|
| Molecular Weight | 231.29000 |
| Exact Mass | 231.12600 |
| PSA | 42.09000 |
| LogP | 3.22460 |
| InChIKey | DOABEWVYDYLWIK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(C)c1c[nH]c2ccccc12 |
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| ethyl 3-(1H-indol-3-yl)bytanoate |
| ethyl β-methyl-1H-indole-3-propionate |
| ethyl 3-(3-indolyl)-butyrate |
| 3-(3-indolyl)butyrate |
| ethyl 3-(3-indolyl)butyrate |
| ethyl 3-(1H-indol-3-yl)butanoate |