2-aminoethyl prop-2-enoate,nitric acid,prop-2-enamide structure
|
Common Name | 2-aminoethyl prop-2-enoate,nitric acid,prop-2-enamide | ||
|---|---|---|---|---|
| CAS Number | 67990-39-0 | Molecular Weight | 249.22100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H15N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-aminoethyl prop-2-enoate,nitric acid,prop-2-enamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H15N3O6 |
|---|---|
| Molecular Weight | 249.22100 |
| Exact Mass | 249.09600 |
| PSA | 162.45000 |
| LogP | 1.35750 |
| InChIKey | WSNKFGXYLPCBIB-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OCCN.C=CC(N)=O.O=[N+]([O-])O |
| 2-Propenoic acid,2-aminoethyl ester,nitrate,polymer with 2-propenamide |
| 2-Propenoic acid,2-aminoethyl ester,nitrate (1:1),polymer with 2-propenamide |