Octanoic acid p-iodobenzyl ester
Modify Date: 2025-08-26 20:39:08
Octanoic acid p-iodobenzyl ester structure
|
Common Name | Octanoic acid p-iodobenzyl ester | ||
|---|---|---|---|---|
| CAS Number | 67987-34-2 | Molecular Weight | 360.23100 | |
| Density | 1.367g/cm3 | Boiling Point | 365.2ºC at 760 mmHg | |
| Molecular Formula | C15H21IO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.6ºC | |
| Name | (4-iodophenyl)methyl octanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.367g/cm3 |
|---|---|
| Boiling Point | 365.2ºC at 760 mmHg |
| Molecular Formula | C15H21IO2 |
| Molecular Weight | 360.23100 |
| Flash Point | 174.6ºC |
| Exact Mass | 360.05900 |
| PSA | 26.30000 |
| LogP | 4.69490 |
| Index of Refraction | 1.542 |
| InChIKey | SVYNEJFXKXPMLE-UHFFFAOYSA-N |
| SMILES | CCCCCCCC(=O)OCc1ccc(I)cc1 |
|
~%
Octanoic acid p... CAS#:67987-34-2 |
| Literature: Newton Journal of Pharmaceutical Sciences, 1978 , vol. 67, # 8 p. 1154 - 1157 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| p-Iodobenzyl octanoate |
| OCTANOIC ACID,p-IODOBENZYL ESTER |