4-aminobenzoic acid,2-(chloromethyl)oxirane,4-[2-(4-hydroxyphenyl)propan-2-yl]phenol
Modify Date: 2025-08-26 15:14:28
![4-aminobenzoic acid,2-(chloromethyl)oxirane,4-[2-(4-hydroxyphenyl)propan-2-yl]phenol Structure](https://image.chemsrc.com/caspic/128/67906-76-7.png)
4-aminobenzoic acid,2-(chloromethyl)oxirane,4-[2-(4-hydroxyphenyl)propan-2-yl]phenol structure
|
Common Name | 4-aminobenzoic acid,2-(chloromethyl)oxirane,4-[2-(4-hydroxyphenyl)propan-2-yl]phenol | ||
|---|---|---|---|---|
| CAS Number | 67906-76-7 | Molecular Weight | 457.94700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H28ClNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-aminobenzoic acid,2-(chloromethyl)oxirane,4-[2-(4-hydroxyphenyl)propan-2-yl]phenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C25H28ClNO5 |
|---|---|
| Molecular Weight | 457.94700 |
| Exact Mass | 457.16600 |
| PSA | 116.31000 |
| LogP | 5.59590 |
| InChIKey | IEQRFPYJAZPMDM-UHFFFAOYSA-N |
| SMILES | CC(C)(c1ccc(O)cc1)c1ccc(O)cc1.ClCC1CO1.Nc1ccc(C(=O)O)cc1 |
| Benzoic acid,4-amino-,polymer with (chloromethyl)oxirane and 4,4'-(1-methylethylidene)bis(phenol) |
| Benzoic acid,4-amino-,polymer with 2-(chloromethyl)oxirane and 4,4'-(1-methylethylidene)bis(phenol) |
| Bisphenol A,epichlorohydrin,p-aminobenzoic acid polymer |
| p-Aminobenzoic acid,bisphenol A,(chloromethyl)oxirane polymer |