carbononitridic chloride,1-[4-[[4-(2,5-dioxopyrrol-1-yl)phenyl]methyl]phenyl]pyrrole-2,5-dione,4-[2-(4-hydroxyphenyl)propan-2-yl]phenol structure
|
Common Name | carbononitridic chloride,1-[4-[[4-(2,5-dioxopyrrol-1-yl)phenyl]methyl]phenyl]pyrrole-2,5-dione,4-[2-(4-hydroxyphenyl)propan-2-yl]phenol | ||
|---|---|---|---|---|
| CAS Number | 67892-90-4 | Molecular Weight | 648.10400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C37H30ClN3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | carbononitridic chloride,1-[4-[[4-(2,5-dioxopyrrol-1-yl)phenyl]methyl]phenyl]pyrrole-2,5-dione,4-[2-(4-hydroxyphenyl)propan-2-yl]phenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C37H30ClN3O6 |
|---|---|
| Molecular Weight | 648.10400 |
| Exact Mass | 647.18200 |
| PSA | 139.01000 |
| LogP | 6.39618 |
| InChIKey | XUFHKHLPVYVZBR-UHFFFAOYSA-N |
| SMILES | CC(C)(c1ccc(O)cc1)c1ccc(O)cc1.N#CCl.O=C1C=CC(=O)N1c1ccc(Cc2ccc(N3C(=O)C=CC3=O)cc2)cc1 |
| carbononitridic chloride |
| Bisphenol A,4,4'-diphenylmethanebismaleimide,cyanogen chloride polymer |
| 1-[4-[[4-(2,5-dioxopyrrol-1-yl)phenyl]methyl]phenyl]pyrrole-2,5-dione |
| Cyanogen chloride ((CN)Cl),polymer with 1,1'-(methylenedi-4,1-phenylene)bis(1H-pyrrole-2,5-dione) and 4,4'-(1-methylethylidene)bis(phenol) |