dimethyl hexanedioate,dimethyl pentanedioate,[4-(hydroxymethyl)cyclohexyl]methanol
Modify Date: 2025-11-07 11:27:34
![dimethyl hexanedioate,dimethyl pentanedioate,[4-(hydroxymethyl)cyclohexyl]methanol Structure](https://image.chemsrc.com/caspic/359/67892-58-4.png)
dimethyl hexanedioate,dimethyl pentanedioate,[4-(hydroxymethyl)cyclohexyl]methanol structure
|
Common Name | dimethyl hexanedioate,dimethyl pentanedioate,[4-(hydroxymethyl)cyclohexyl]methanol | ||
|---|---|---|---|---|
| CAS Number | 67892-58-4 | Molecular Weight | 478.57400 | |
| Density | N/A | Boiling Point | 228.7ºC at 760 mmHg | |
| Molecular Formula | C23H42O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 107.2ºC | |
| Name | dimethyl hexanedioate,dimethyl pentanedioate,[4-(hydroxymethyl)cyclohexyl]methanol |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 228.7ºC at 760 mmHg |
|---|---|
| Molecular Formula | C23H42O10 |
| Molecular Weight | 478.57400 |
| Flash Point | 107.2ºC |
| Exact Mass | 478.27800 |
| PSA | 145.66000 |
| LogP | 2.17290 |
| InChIKey | HSZFBYYDKJEOHQ-UHFFFAOYSA-N |
| SMILES | COC(=O)CCCC(=O)OC.COC(=O)CCCCC(=O)OC.OCC1CCC(CO)CC1 |
| Hexanedioic acid,dimethyl ester,polymer with 1,4-cyclohexanedimethanol and dimethyl pentanedioate |
| Hexanedioic acid,1,6-dimethyl ester,polymer with 1,4-cyclohexanedimethanol and 1,5-dimethyl pentanedioate |
| 1,4-Cyclohexanedimethanol,dimethyl adipate,dimethyl glutarate polymer |