5-benzo[1,3]dioxol-5-yl-N-(4-methoxyphenyl)-1,3,4-oxadiazol-2-amine structure
|
Common Name | 5-benzo[1,3]dioxol-5-yl-N-(4-methoxyphenyl)-1,3,4-oxadiazol-2-amine | ||
|---|---|---|---|---|
| CAS Number | 67829-27-0 | Molecular Weight | 311.29200 | |
| Density | 1.382g/cm3 | Boiling Point | 483.9ºC at 760 mmHg | |
| Molecular Formula | C16H13N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.5ºC | |
| Name | 5-(1,3-benzodioxol-5-yl)-N-(4-methoxyphenyl)-1,3,4-oxadiazol-2-amine |
|---|
| Density | 1.382g/cm3 |
|---|---|
| Boiling Point | 483.9ºC at 760 mmHg |
| Molecular Formula | C16H13N3O4 |
| Molecular Weight | 311.29200 |
| Flash Point | 246.5ºC |
| Exact Mass | 311.09100 |
| PSA | 78.64000 |
| LogP | 3.29050 |
| Index of Refraction | 1.644 |
| InChIKey | MXQFLBXWIIRXIW-UHFFFAOYSA-N |
| SMILES | COc1ccc(Nc2nnc(-c3ccc4c(c3)OCO4)o2)cc1 |
|
~%
5-benzo[1,3]dio... CAS#:67829-27-0 |
| Literature: Chaudhary; Kumar; Parmar Journal of Pharmaceutical Sciences, 1978 , vol. 67, # 7 p. 987 - 990 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |