(2,2-dibromo-1,1-diethoxyethyl)benzene structure
|
Common Name | (2,2-dibromo-1,1-diethoxyethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 67824-62-8 | Molecular Weight | 352.06200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16Br2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2,2-dibromo-1,1-diethoxyethyl)benzene |
|---|
| Molecular Formula | C12H16Br2O2 |
|---|---|
| Molecular Weight | 352.06200 |
| Exact Mass | 349.95200 |
| PSA | 18.46000 |
| LogP | 4.02830 |
| InChIKey | ZNCMUUKZJGTXOI-UHFFFAOYSA-N |
| SMILES | CCOC(OCC)(c1ccccc1)C(Br)Br |
|
~%
(2,2-dibromo-1,... CAS#:67824-62-8 |
| Literature: Uemura,S. et al. Bulletin of the Chemical Society of Japan, 1978 , vol. 51, p. 1911 - 1912 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |