2-[3,5-bis(trifluoromethyl)phenyl]indene-1,3-dione structure
|
Common Name | 2-[3,5-bis(trifluoromethyl)phenyl]indene-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 67810-63-3 | Molecular Weight | 358.23500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H8F6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[3,5-bis(trifluoromethyl)phenyl]indene-1,3-dione |
|---|
| Molecular Formula | C17H8F6O2 |
|---|---|
| Molecular Weight | 358.23500 |
| Exact Mass | 358.04300 |
| PSA | 34.14000 |
| LogP | 4.88700 |
| InChIKey | PTIDILCMTSFARB-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)C1c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
|
~%
2-[3,5-bis(trif... CAS#:67810-63-3 |
| Literature: Eriks Ch.; Van Der Goot; Nauta Th. European Journal of Medicinal Chemistry, 1979 , vol. 14, # 5 p. 411 - 414 |
|
~%
2-[3,5-bis(trif... CAS#:67810-63-3 |
| Literature: Eriks Ch.; Van Der Goot; Nauta Th. European Journal of Medicinal Chemistry, 1979 , vol. 14, # 5 p. 411 - 414 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |