Trichlorobis(pentafluorophenyl)phosphorane structure
|
Common Name | Trichlorobis(pentafluorophenyl)phosphorane | ||
|---|---|---|---|---|
| CAS Number | 6779-72-2 | Molecular Weight | 471.44500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12Cl3F10P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trichloro-bis(2,3,4,5,6-pentafluorophenyl)-λ5-phosphane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12Cl3F10P |
|---|---|
| Molecular Weight | 471.44500 |
| Exact Mass | 469.86400 |
| PSA | 13.59000 |
| LogP | 6.04310 |
| InChIKey | MHJWEVPELOAYIK-UHFFFAOYSA-N |
| SMILES | Fc1c(F)c(F)c(P(Cl)(Cl)(Cl)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| HS Code | 2931900090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| trichloro-bis(2,3,4,5,6-pentafluorophenyl)- |
| l^{5}-phosphane |
| Trichlorobis(pentafluorophenyl)phosphorane |